C13H25ClN4 — CID 105039116
1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]hexan-1-amine (PubChem CID 105039116) has the molecular formula C13H25ClN4 and a molecular weight of 272.82 g/mol. Its IUPAC name is 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]hexan-1-amine.
| Compound Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]hexan-1-amine |
|---|---|
| PubChem CID | 105039116 |
| Molecular Formula | C13H25ClN4 |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]hexan-1-amine |
| SMILES | CCCCCC(N)c1c(Cl)cnn1CCN(C)C |
| InChI | InChI=1S/C13H25ClN4/c1-4-5-6-7-12(15)13-11(14)10-16-18(13)9-8-17(2)3/h10,12H,4-9,15H2,1-3H3 |
| InChIKey | GQCTVFYTNWLZEA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|