C12H23ClN4 — CID 114663857
1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]pentan-3-amine (PubChem CID 114663857) has the molecular formula C12H23ClN4 and a molecular weight of 258.80 g/mol. Its IUPAC name is 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]pentan-3-amine.
| Compound Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]pentan-3-amine |
|---|---|
| PubChem CID | 114663857 |
| Molecular Formula | C12H23ClN4 |
| Molecular Weight | 258.80 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]pentan-3-amine |
| SMILES | CCC(N)CCc1c(Cl)cnn1CCN(C)C |
| InChI | InChI=1S/C12H23ClN4/c1-4-10(14)5-6-12-11(13)9-15-17(12)8-7-16(2)3/h9-10H,4-8,14H2,1-3H3 |
| InChIKey | OPQWAEQLZXHCJA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.80 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |