C15H27ClN4 — CID 114664348
3-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-cyclopropyl-N-ethylpropan-1-amine (PubChem CID 114664348) has the molecular formula C15H27ClN4 and a molecular weight of 298.86 g/mol. Its IUPAC name is 3-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-cyclopropyl-N-ethylpropan-1-amine.
| Compound Name | 3-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-cyclopropyl-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 114664348 |
| Molecular Formula | C15H27ClN4 |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 3-[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]-1-cyclopropyl-N-ethylpropan-1-amine |
| SMILES | CCNC(CCc1c(Cl)cnn1CCN(C)C)C1CC1 |
| InChI | InChI=1S/C15H27ClN4/c1-4-17-14(12-5-6-12)7-8-15-13(16)11-18-20(15)10-9-19(2)3/h11-12,14,17H,4-10H2,1-3H3 |
| InChIKey | AFFABXPYQMEKII-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |