C11H17ClN6 — CID 105228861
[2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(1-methylpyrazol-3-yl)ethyl]hydrazine (PubChem CID 105228861) has the molecular formula C11H17ClN6 and a molecular weight of 268.75 g/mol. Its IUPAC name is [2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(1-methylpyrazol-3-yl)ethyl]hydrazine.
| Compound Name | [2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(1-methylpyrazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105228861 |
| Molecular Formula | C11H17ClN6 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(1-methylpyrazol-3-yl)ethyl]hydrazine |
| SMILES | Cc1nn(C)c(Cl)c1CC(NN)c1ccn(C)n1 |
| InChI | InChI=1S/C11H17ClN6/c1-7-8(11(12)18(3)15-7)6-10(14-13)9-4-5-17(2)16-9/h4-5,10,14H,6,13H2,1-3H3 |
| InChIKey | UAPGJASGOKVHDL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|