C13H19ClN6 — CID 105334091
[2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(3,6-dimethylpyridazin-4-yl)ethyl]hydrazine (PubChem CID 105334091) has the molecular formula C13H19ClN6 and a molecular weight of 294.79 g/mol. Its IUPAC name is [2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(3,6-dimethylpyridazin-4-yl)ethyl]hydrazine.
| Compound Name | [2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(3,6-dimethylpyridazin-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105334091 |
| Molecular Formula | C13H19ClN6 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [2-(5-chloro-1,3-dimethylpyrazol-4-yl)-1-(3,6-dimethylpyridazin-4-yl)ethyl]hydrazine |
| SMILES | Cc1cc(C(Cc2c(C)nn(C)c2Cl)NN)c(C)nn1 |
| InChI | InChI=1S/C13H19ClN6/c1-7-5-10(8(2)18-17-7)12(16-15)6-11-9(3)19-20(4)13(11)14/h5,12,16H,6,15H2,1-4H3 |
| InChIKey | RCQGSNDECIOARJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|