C15H26O2Te — CID 10522891
2-[(2E,4Z)-5-butyltellanyl-3-methylpenta-2,4-dienoxy]oxane (PubChem CID 10522891) has the molecular formula C15H26O2Te and a molecular weight of 365.97 g/mol. Its IUPAC name is 2-[(2E,4Z)-5-butyltellanyl-3-methylpenta-2,4-dienoxy]oxane.
| Compound Name | 2-[(2E,4Z)-5-butyltellanyl-3-methylpenta-2,4-dienoxy]oxane |
|---|---|
| PubChem CID | 10522891 |
| Molecular Formula | C15H26O2Te |
| Molecular Weight | 365.97 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-[(2E,4Z)-5-butyltellanyl-3-methylpenta-2,4-dienoxy]oxane |
| SMILES | CCCC[Te]/C=C\C(C)=C\COC1CCCCO1 |
| InChI | InChI=1S/C15H26O2Te/c1-3-4-12-18-13-9-14(2)8-11-17-15-7-5-6-10-16-15/h8-9,13,15H,3-7,10-12H2,1-2H3/b13-9-,14-8+ |
| InChIKey | QMDCLBGIBHQFQK-SUUJTOJZSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.97 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|