C13H21N3O — CID 105229310
[2-(5-ethyl-2-pyridinyl)-1-(oxolan-3-yl)ethyl]hydrazine (PubChem CID 105229310) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is [2-(5-ethyl-2-pyridinyl)-1-(oxolan-3-yl)ethyl]hydrazine.
| Compound Name | [2-(5-ethyl-2-pyridinyl)-1-(oxolan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105229310 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [2-(5-ethyl-2-pyridinyl)-1-(oxolan-3-yl)ethyl]hydrazine |
| SMILES | CCc1ccc(CC(NN)C2CCOC2)nc1 |
| InChI | InChI=1S/C13H21N3O/c1-2-10-3-4-12(15-8-10)7-13(16-14)11-5-6-17-9-11/h3-4,8,11,13,16H,2,5-7,9,14H2,1H3 |
| InChIKey | JXFWESHZJMHONS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|