C12H20N2OS — CID 105229403
[2-(5-ethylthiophen-2-yl)-1-(oxolan-3-yl)ethyl]hydrazine (PubChem CID 105229403) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is [2-(5-ethylthiophen-2-yl)-1-(oxolan-3-yl)ethyl]hydrazine.
| Compound Name | [2-(5-ethylthiophen-2-yl)-1-(oxolan-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105229403 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | [2-(5-ethylthiophen-2-yl)-1-(oxolan-3-yl)ethyl]hydrazine |
| SMILES | CCc1ccc(CC(NN)C2CCOC2)s1 |
| InChI | InChI=1S/C12H20N2OS/c1-2-10-3-4-11(16-10)7-12(14-13)9-5-6-15-8-9/h3-4,9,12,14H,2,5-8,13H2,1H3 |
| InChIKey | JVTOJJNOYXLBNW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|