C10H16N2OS — CID 105229457
[1-(oxolan-3-yl)-2-thiophen-3-ylethyl]hydrazine (PubChem CID 105229457) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is [1-(oxolan-3-yl)-2-thiophen-3-ylethyl]hydrazine.
| Compound Name | [1-(oxolan-3-yl)-2-thiophen-3-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105229457 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | [1-(oxolan-3-yl)-2-thiophen-3-ylethyl]hydrazine |
| SMILES | NNC(Cc1ccsc1)C1CCOC1 |
| InChI | InChI=1S/C10H16N2OS/c11-12-10(9-1-3-13-6-9)5-8-2-4-14-7-8/h2,4,7,9-10,12H,1,3,5-6,11H2 |
| InChIKey | QQCQARDFOIBVTA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|