C15H25N3O2 — CID 105229756
[2-(4-methoxy-3,5-dimethyl-2-pyridinyl)-1-(oxan-4-yl)ethyl]hydrazine (PubChem CID 105229756) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is [2-(4-methoxy-3,5-dimethyl-2-pyridinyl)-1-(oxan-4-yl)ethyl]hydrazine.
| Compound Name | [2-(4-methoxy-3,5-dimethyl-2-pyridinyl)-1-(oxan-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105229756 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | [2-(4-methoxy-3,5-dimethyl-2-pyridinyl)-1-(oxan-4-yl)ethyl]hydrazine |
| SMILES | COc1c(C)cnc(CC(NN)C2CCOCC2)c1C |
| InChI | InChI=1S/C15H25N3O2/c1-10-9-17-13(11(2)15(10)19-3)8-14(18-16)12-4-6-20-7-5-12/h9,12,14,18H,4-8,16H2,1-3H3 |
| InChIKey | UPQDLLBXAVDDBT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|