C15H26N4OS — CID 106446308
[2-(4-methoxy-3,5-dimethyl-2-pyridinyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine (PubChem CID 106446308) has the molecular formula C15H26N4OS and a molecular weight of 310.47 g/mol. Its IUPAC name is [2-(4-methoxy-3,5-dimethyl-2-pyridinyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine.
| Compound Name | [2-(4-methoxy-3,5-dimethyl-2-pyridinyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106446308 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | [2-(4-methoxy-3,5-dimethyl-2-pyridinyl)-1-(4-methylthiomorpholin-3-yl)ethyl]hydrazine |
| SMILES | COc1c(C)cnc(CC(NN)C2CSCCN2C)c1C |
| InChI | InChI=1S/C15H26N4OS/c1-10-8-17-12(11(2)15(10)20-4)7-13(18-16)14-9-21-6-5-19(14)3/h8,13-14,18H,5-7,9,16H2,1-4H3 |
| InChIKey | SONFWISGJHFVHP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|