C15H16N2O5S2 — CID 10523054
(2S)-2-(4-oxo-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-3-yl)pentanedioic acid (PubChem CID 10523054) has the molecular formula C15H16N2O5S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (2S)-2-(4-oxo-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-3-yl)pentanedioic acid.
| Compound Name | (2S)-2-(4-oxo-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-3-yl)pentanedioic acid |
|---|---|
| PubChem CID | 10523054 |
| Molecular Formula | C15H16N2O5S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (2S)-2-(4-oxo-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-3-yl)pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](C(=O)O)n1c(=S)[nH]c2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C15H16N2O5S2/c18-10(19)6-5-8(14(21)22)17-13(20)11-7-3-1-2-4-9(7)24-12(11)16-15(17)23/h8H,1-6H2,(H,16,23)(H,18,19)(H,21,22)/t8-/m0/s1 |
| InChIKey | IASMGNUQZOUJPJ-QMMMGPOBSA-N |
| XLogP | 2.49 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|