C21H22N2O4S2 — CID 17334014
3-(3,5-diethoxybenzoyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 17334014) has the molecular formula C21H22N2O4S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-(3,5-diethoxybenzoyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(3,5-diethoxybenzoyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 17334014 |
| Molecular Formula | C21H22N2O4S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-(3,5-diethoxybenzoyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCOc1cc(OCC)cc(C(=O)n2c(=S)[nH]c3sc4c(c3c2=O)CCCC4)c1 |
| InChI | InChI=1S/C21H22N2O4S2/c1-3-26-13-9-12(10-14(11-13)27-4-2)19(24)23-20(25)17-15-7-5-6-8-16(15)29-18(17)22-21(23)28/h9-11H,3-8H2,1-2H3,(H,22,28) |
| InChIKey | REGNNZXOEHZSCM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|