C17H12ClIN2O2S2 — CID 17334035
3-(2-chloro-5-iodobenzoyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 17334035) has the molecular formula C17H12ClIN2O2S2 and a molecular weight of 502.79 g/mol. Its IUPAC name is 3-(2-chloro-5-iodobenzoyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(2-chloro-5-iodobenzoyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 17334035 |
| Molecular Formula | C17H12ClIN2O2S2 |
| Molecular Weight | 502.79 g/mol |
| Exact Mass | 501.91 |
| IUPAC Name | 3-(2-chloro-5-iodobenzoyl)-2-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C(c1cc(I)ccc1Cl)n1c(=S)[nH]c2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C17H12ClIN2O2S2/c18-11-6-5-8(19)7-10(11)15(22)21-16(23)13-9-3-1-2-4-12(9)25-14(13)20-17(21)24/h5-7H,1-4H2,(H,20,24) |
| InChIKey | SZKWRXZDMSMBFH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|