C11H10FN5O — CID 105230636
[(7-fluoro-1-benzofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methyl]hydrazine (PubChem CID 105230636) has the molecular formula C11H10FN5O and a molecular weight of 247.23 g/mol. Its IUPAC name is [(7-fluoro-1-benzofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methyl]hydrazine.
| Compound Name | [(7-fluoro-1-benzofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105230636 |
| Molecular Formula | C11H10FN5O |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | [(7-fluoro-1-benzofuran-2-yl)-(1H-1,2,4-triazol-5-yl)methyl]hydrazine |
| SMILES | NNC(c1ncn[nH]1)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C11H10FN5O/c12-7-3-1-2-6-4-8(18-10(6)7)9(16-13)11-14-5-15-17-11/h1-5,9,16H,13H2,(H,14,15,17) |
| InChIKey | OZFWOYRWUZENRG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|