C16H16FN3O — CID 105262308
[(3-ethyl-4-pyridinyl)-(7-fluoro-1-benzofuran-2-yl)methyl]hydrazine (PubChem CID 105262308) has the molecular formula C16H16FN3O and a molecular weight of 285.32 g/mol. Its IUPAC name is [(3-ethyl-4-pyridinyl)-(7-fluoro-1-benzofuran-2-yl)methyl]hydrazine.
| Compound Name | [(3-ethyl-4-pyridinyl)-(7-fluoro-1-benzofuran-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105262308 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | [(3-ethyl-4-pyridinyl)-(7-fluoro-1-benzofuran-2-yl)methyl]hydrazine |
| SMILES | CCc1cnccc1C(NN)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C16H16FN3O/c1-2-10-9-19-7-6-12(10)15(20-18)14-8-11-4-3-5-13(17)16(11)21-14/h3-9,15,20H,2,18H2,1H3 |
| InChIKey | PQLAMRAFQOFLPA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|