C13H23N5O2 — CID 105231085
4-[1,9-dioxaspiro[5.5]undecan-4-yl(hydrazinyl)methyl]-1H-pyrazol-5-amine (PubChem CID 105231085) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-[1,9-dioxaspiro[5.5]undecan-4-yl(hydrazinyl)methyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[1,9-dioxaspiro[5.5]undecan-4-yl(hydrazinyl)methyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231085 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 4-[1,9-dioxaspiro[5.5]undecan-4-yl(hydrazinyl)methyl]-1H-pyrazol-5-amine |
| SMILES | NNC(c1cn[nH]c1N)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C13H23N5O2/c14-12-10(8-16-18-12)11(17-15)9-1-4-20-13(7-9)2-5-19-6-3-13/h8-9,11,17H,1-7,15H2,(H3,14,16,18) |
| InChIKey | LTYGPNIKTBRSIW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|