C18H30N2O — CID 105231854
[(4,4-dimethylcyclohexyl)-(4-methoxy-2,5-dimethylphenyl)methyl]hydrazine (PubChem CID 105231854) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is [(4,4-dimethylcyclohexyl)-(4-methoxy-2,5-dimethylphenyl)methyl]hydrazine.
| Compound Name | [(4,4-dimethylcyclohexyl)-(4-methoxy-2,5-dimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105231854 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | [(4,4-dimethylcyclohexyl)-(4-methoxy-2,5-dimethylphenyl)methyl]hydrazine |
| SMILES | COc1cc(C)c(C(NN)C2CCC(C)(C)CC2)cc1C |
| InChI | InChI=1S/C18H30N2O/c1-12-11-16(21-5)13(2)10-15(12)17(20-19)14-6-8-18(3,4)9-7-14/h10-11,14,17,20H,6-9,19H2,1-5H3 |
| InChIKey | ZENBQKWXVGIAPY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|