C22H23F2NO2 — CID 10523252
1-[5-(tert-butylamino)-2,2-bis(4-fluorophenyl)-3H-furan-4-yl]ethanone (PubChem CID 10523252) has the molecular formula C22H23F2NO2 and a molecular weight of 371.43 g/mol. Its IUPAC name is 1-[5-(tert-butylamino)-2,2-bis(4-fluorophenyl)-3H-furan-4-yl]ethanone.
| Compound Name | 1-[5-(tert-butylamino)-2,2-bis(4-fluorophenyl)-3H-furan-4-yl]ethanone |
|---|---|
| PubChem CID | 10523252 |
| Molecular Formula | C22H23F2NO2 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-[5-(tert-butylamino)-2,2-bis(4-fluorophenyl)-3H-furan-4-yl]ethanone |
| SMILES | CC(=O)C1=C(NC(C)(C)C)OC(c2ccc(F)cc2)(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H23F2NO2/c1-14(26)19-13-22(15-5-9-17(23)10-6-15,16-7-11-18(24)12-8-16)27-20(19)25-21(2,3)4/h5-12,25H,13H2,1-4H3 |
| InChIKey | YGGAHWMVMUHBRU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |