C20H21NO3 — CID 10639649
1-[5-(2-hydroxyethylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone (PubChem CID 10639649) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-[5-(2-hydroxyethylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone.
| Compound Name | 1-[5-(2-hydroxyethylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone |
|---|---|
| PubChem CID | 10639649 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 1-[5-(2-hydroxyethylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone |
| SMILES | CC(=O)C1=C(NCCO)OC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C20H21NO3/c1-15(23)18-14-20(16-8-4-2-5-9-16,17-10-6-3-7-11-17)24-19(18)21-12-13-22/h2-11,21-22H,12-14H2,1H3 |
| InChIKey | RHTLYKJTYQAQSP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |