C25H23NO2 — CID 10737836
1-[5-(benzylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone (PubChem CID 10737836) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-[5-(benzylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone.
| Compound Name | 1-[5-(benzylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone |
|---|---|
| PubChem CID | 10737836 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[5-(benzylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone |
| SMILES | CC(=O)C1=C(NCc2ccccc2)OC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C25H23NO2/c1-19(27)23-17-25(21-13-7-3-8-14-21,22-15-9-4-10-16-22)28-24(23)26-18-20-11-5-2-6-12-20/h2-16,26H,17-18H2,1H3 |
| InChIKey | MOZYYCWDEYYVJD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |