C25H23NO2 — CID 10642847
N-benzyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide (PubChem CID 10642847) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is N-benzyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide.
| Compound Name | N-benzyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide |
|---|---|
| PubChem CID | 10642847 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | N-benzyl-5-methyl-2,2-diphenyl-3H-furan-4-carboxamide |
| SMILES | CC1=C(C(=O)NCc2ccccc2)CC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C25H23NO2/c1-19-23(24(27)26-18-20-11-5-2-6-12-20)17-25(28-19,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16H,17-18H2,1H3,(H,26,27) |
| InChIKey | UEDYRSZANPIGLJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |