C23H29NO2 — CID 142400943
3-[4-[(benzylamino)methoxymethyl]phenyl]-5,5-dimethylcyclohex-2-en-1-one;molecular hydrogen (PubChem CID 142400943) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 3-[4-[(benzylamino)methoxymethyl]phenyl]-5,5-dimethylcyclohex-2-en-1-one;molecular hydrogen.
| Compound Name | 3-[4-[(benzylamino)methoxymethyl]phenyl]-5,5-dimethylcyclohex-2-en-1-one;molecular hydrogen |
|---|---|
| PubChem CID | 142400943 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 3-[4-[(benzylamino)methoxymethyl]phenyl]-5,5-dimethylcyclohex-2-en-1-one;molecular hydrogen |
| SMILES | CC1(C)CC(=O)C=C(c2ccc(COCNCc3ccccc3)cc2)C1.[H][H] |
| InChI | InChI=1S/C23H27NO2.H2/c1-23(2)13-21(12-22(25)14-23)20-10-8-19(9-11-20)16-26-17-24-15-18-6-4-3-5-7-18;/h3-12,24H,13-17H2,1-2H3;1H |
| InChIKey | QVQNZBBSYSMCRM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|