C27H37NO2 — CID 169103904
2-(4,5-diphenyl-2,3-dihydro-1,3-oxazol-2-yl)-8-methylnonan-4-one;ethane (PubChem CID 169103904) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 2-(4,5-diphenyl-2,3-dihydro-1,3-oxazol-2-yl)-8-methylnonan-4-one;ethane.
| Compound Name | 2-(4,5-diphenyl-2,3-dihydro-1,3-oxazol-2-yl)-8-methylnonan-4-one;ethane |
|---|---|
| PubChem CID | 169103904 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 2-(4,5-diphenyl-2,3-dihydro-1,3-oxazol-2-yl)-8-methylnonan-4-one;ethane |
| SMILES | CC.CC(C)CCCC(=O)CC(C)C1NC(c2ccccc2)=C(c2ccccc2)O1 |
| InChI | InChI=1S/C25H31NO2.C2H6/c1-18(2)11-10-16-22(27)17-19(3)25-26-23(20-12-6-4-7-13-20)24(28-25)21-14-8-5-9-15-21;1-2/h4-9,12-15,18-19,25-26H,10-11,16-17H2,1-3H3;1-2H3 |
| InChIKey | VAWVVKSWKQSEJR-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|