C22H25NO2 — CID 10759251
1-[5-(tert-butylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone (PubChem CID 10759251) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[5-(tert-butylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone.
| Compound Name | 1-[5-(tert-butylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone |
|---|---|
| PubChem CID | 10759251 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-[5-(tert-butylamino)-2,2-diphenyl-3H-furan-4-yl]ethanone |
| SMILES | CC(=O)C1=C(NC(C)(C)C)OC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C22H25NO2/c1-16(24)19-15-22(17-11-7-5-8-12-17,18-13-9-6-10-14-18)25-20(19)23-21(2,3)4/h5-14,23H,15H2,1-4H3 |
| InChIKey | NWHLSJBCQAJLCY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |