C20H20O5S — CID 10523315
ethyl (2R,3S)-3-(benzenesulfonyl)-4-methylidene-2-phenyloxolane-3-carboxylate (PubChem CID 10523315) has the molecular formula C20H20O5S and a molecular weight of 372.44 g/mol. Its IUPAC name is ethyl (2R,3S)-3-(benzenesulfonyl)-4-methylidene-2-phenyloxolane-3-carboxylate.
| Compound Name | ethyl (2R,3S)-3-(benzenesulfonyl)-4-methylidene-2-phenyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 10523315 |
| Molecular Formula | C20H20O5S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | ethyl (2R,3S)-3-(benzenesulfonyl)-4-methylidene-2-phenyloxolane-3-carboxylate |
| SMILES | C=C1CO[C@H](c2ccccc2)[C@@]1(C(=O)OCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O5S/c1-3-24-19(21)20(26(22,23)17-12-8-5-9-13-17)15(2)14-25-18(20)16-10-6-4-7-11-16/h4-13,18H,2-3,14H2,1H3/t18-,20+/m1/s1 |
| InChIKey | RNNNNBDIEPDYHZ-QUCCMNQESA-N |
| XLogP | 3.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|