C16H13FO2S — CID 11748209
(3S,5R)-3-fluoro-5-phenyl-3-phenylsulfanyloxolan-2-one (PubChem CID 11748209) has the molecular formula C16H13FO2S and a molecular weight of 288.34 g/mol. Its IUPAC name is (3S,5R)-3-fluoro-5-phenyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (3S,5R)-3-fluoro-5-phenyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 11748209 |
| Molecular Formula | C16H13FO2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | (3S,5R)-3-fluoro-5-phenyl-3-phenylsulfanyloxolan-2-one |
| SMILES | O=C1O[C@@H](c2ccccc2)C[C@]1(F)Sc1ccccc1 |
| InChI | InChI=1S/C16H13FO2S/c17-16(20-13-9-5-2-6-10-13)11-14(19-15(16)18)12-7-3-1-4-8-12/h1-10,14H,11H2/t14-,16+/m1/s1 |
| InChIKey | IDWCXMNZQWOAPT-ZBFHGGJFSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |