C16H13FO3S — CID 46930651
(3R,4R,5S)-3-(4-fluorophenyl)sulfanyl-4-hydroxy-5-phenyloxolan-2-one (PubChem CID 46930651) has the molecular formula C16H13FO3S and a molecular weight of 304.34 g/mol. Its IUPAC name is (3R,4R,5S)-3-(4-fluorophenyl)sulfanyl-4-hydroxy-5-phenyloxolan-2-one.
| Compound Name | (3R,4R,5S)-3-(4-fluorophenyl)sulfanyl-4-hydroxy-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 46930651 |
| Molecular Formula | C16H13FO3S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | (3R,4R,5S)-3-(4-fluorophenyl)sulfanyl-4-hydroxy-5-phenyloxolan-2-one |
| SMILES | O=C1O[C@@H](c2ccccc2)[C@@H](O)[C@H]1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13FO3S/c17-11-6-8-12(9-7-11)21-15-13(18)14(20-16(15)19)10-4-2-1-3-5-10/h1-9,13-15,18H/t13-,14+,15-/m1/s1 |
| InChIKey | HDHWQOXOLQRBDK-QLFBSQMISA-N |
| XLogP | 2.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |