C17H16F2O3S — CID 141047093
[2-(2-fluoro-4-methylsulfanylphenyl)-2-hydroxyethyl] 2-(4-fluorophenyl)acetate (PubChem CID 141047093) has the molecular formula C17H16F2O3S and a molecular weight of 338.38 g/mol. Its IUPAC name is [2-(2-fluoro-4-methylsulfanylphenyl)-2-hydroxyethyl] 2-(4-fluorophenyl)acetate.
| Compound Name | [2-(2-fluoro-4-methylsulfanylphenyl)-2-hydroxyethyl] 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 141047093 |
| Molecular Formula | C17H16F2O3S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | [2-(2-fluoro-4-methylsulfanylphenyl)-2-hydroxyethyl] 2-(4-fluorophenyl)acetate |
| SMILES | CSc1ccc(C(O)COC(=O)Cc2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C17H16F2O3S/c1-23-13-6-7-14(15(19)9-13)16(20)10-22-17(21)8-11-2-4-12(18)5-3-11/h2-7,9,16,20H,8,10H2,1H3 |
| InChIKey | OIUFSYSWCUAXSB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |