C18H22N2 — CID 105234270
[2,3-dihydro-1H-inden-2-yl-(3,5-dimethylphenyl)methyl]hydrazine (PubChem CID 105234270) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is [2,3-dihydro-1H-inden-2-yl-(3,5-dimethylphenyl)methyl]hydrazine.
| Compound Name | [2,3-dihydro-1H-inden-2-yl-(3,5-dimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105234270 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | [2,3-dihydro-1H-inden-2-yl-(3,5-dimethylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C)cc(C(NN)C2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H22N2/c1-12-7-13(2)9-16(8-12)18(20-19)17-10-14-5-3-4-6-15(14)11-17/h3-9,17-18,20H,10-11,19H2,1-2H3 |
| InChIKey | HGOWPSIRUVKQIX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|