C18H21FN2 — CID 105234720
[(3-fluoro-5-methylphenyl)-(1,2,3,4-tetrahydronaphthalen-2-yl)methyl]hydrazine (PubChem CID 105234720) has the molecular formula C18H21FN2 and a molecular weight of 284.38 g/mol. Its IUPAC name is [(3-fluoro-5-methylphenyl)-(1,2,3,4-tetrahydronaphthalen-2-yl)methyl]hydrazine.
| Compound Name | [(3-fluoro-5-methylphenyl)-(1,2,3,4-tetrahydronaphthalen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105234720 |
| Molecular Formula | C18H21FN2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | [(3-fluoro-5-methylphenyl)-(1,2,3,4-tetrahydronaphthalen-2-yl)methyl]hydrazine |
| SMILES | Cc1cc(F)cc(C(NN)C2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H21FN2/c1-12-8-16(11-17(19)9-12)18(21-20)15-7-6-13-4-2-3-5-14(13)10-15/h2-5,8-9,11,15,18,21H,6-7,10,20H2,1H3 |
| InChIKey | WDHOKDBQCMCIHM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|