C20H13N3OS2 — CID 10523520
9-methyl-14-phenyl-13-sulfanylidene-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one (PubChem CID 10523520) has the molecular formula C20H13N3OS2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 9-methyl-14-phenyl-13-sulfanylidene-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one.
| Compound Name | 9-methyl-14-phenyl-13-sulfanylidene-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one |
|---|---|
| PubChem CID | 10523520 |
| Molecular Formula | C20H13N3OS2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 9-methyl-14-phenyl-13-sulfanylidene-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one |
| SMILES | Cc1c2ccccc2nc2sc3c(=O)n(-c4ccccc4)c(=S)[nH]c3c12 |
| InChI | InChI=1S/C20H13N3OS2/c1-11-13-9-5-6-10-14(13)21-18-15(11)16-17(26-18)19(24)23(20(25)22-16)12-7-3-2-4-8-12/h2-10H,1H3,(H,22,25) |
| InChIKey | YOFUSLSLUVRQBC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|