C14H29N3 — CID 105240416
[2-(azepan-1-yl)-2,5-dimethylhex-4-en-3-yl]hydrazine (PubChem CID 105240416) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is [2-(azepan-1-yl)-2,5-dimethylhex-4-en-3-yl]hydrazine.
| Compound Name | [2-(azepan-1-yl)-2,5-dimethylhex-4-en-3-yl]hydrazine |
|---|---|
| PubChem CID | 105240416 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | [2-(azepan-1-yl)-2,5-dimethylhex-4-en-3-yl]hydrazine |
| SMILES | CC(C)=CC(NN)C(C)(C)N1CCCCCC1 |
| InChI | InChI=1S/C14H29N3/c1-12(2)11-13(16-15)14(3,4)17-9-7-5-6-8-10-17/h11,13,16H,5-10,15H2,1-4H3 |
| InChIKey | JHYIZNSZLSYMTL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|