C12H27N3 — CID 105239399
N,N-diethyl-3-hydrazinyl-2,5-dimethylhex-5-en-2-amine (PubChem CID 105239399) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinyl-2,5-dimethylhex-5-en-2-amine.
| Compound Name | N,N-diethyl-3-hydrazinyl-2,5-dimethylhex-5-en-2-amine |
|---|---|
| PubChem CID | 105239399 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | N,N-diethyl-3-hydrazinyl-2,5-dimethylhex-5-en-2-amine |
| SMILES | C=C(C)CC(NN)C(C)(C)N(CC)CC |
| InChI | InChI=1S/C12H27N3/c1-7-15(8-2)12(5,6)11(14-13)9-10(3)4/h11,14H,3,7-9,13H2,1-2,4-6H3 |
| InChIKey | RXMZDECGXYTNCK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|