C16H29N3 — CID 105240604
1-(3,4-dimethylphenyl)-2-hydrazinyl-N,N,3-trimethylpentan-3-amine (PubChem CID 105240604) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-hydrazinyl-N,N,3-trimethylpentan-3-amine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-hydrazinyl-N,N,3-trimethylpentan-3-amine |
|---|---|
| PubChem CID | 105240604 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-hydrazinyl-N,N,3-trimethylpentan-3-amine |
| SMILES | CCC(C)(C(Cc1ccc(C)c(C)c1)NN)N(C)C |
| InChI | InChI=1S/C16H29N3/c1-7-16(4,19(5)6)15(18-17)11-14-9-8-12(2)13(3)10-14/h8-10,15,18H,7,11,17H2,1-6H3 |
| InChIKey | ZGPZKJZSKCXTFR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|