C14H23F2N3 — CID 105240669
1-(2,4-difluorophenyl)-2-hydrazinyl-N,N,3-trimethylpentan-3-amine (PubChem CID 105240669) has the molecular formula C14H23F2N3 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-hydrazinyl-N,N,3-trimethylpentan-3-amine.
| Compound Name | 1-(2,4-difluorophenyl)-2-hydrazinyl-N,N,3-trimethylpentan-3-amine |
|---|---|
| PubChem CID | 105240669 |
| Molecular Formula | C14H23F2N3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-hydrazinyl-N,N,3-trimethylpentan-3-amine |
| SMILES | CCC(C)(C(Cc1ccc(F)cc1F)NN)N(C)C |
| InChI | InChI=1S/C14H23F2N3/c1-5-14(2,19(3)4)13(18-17)8-10-6-7-11(15)9-12(10)16/h6-7,9,13,18H,5,8,17H2,1-4H3 |
| InChIKey | BAZDTOTYTYRIPT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|