C17H12N4O3S2 — CID 10524075
3-[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 10524075) has the molecular formula C17H12N4O3S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 3-[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10524075 |
| Molecular Formula | C17H12N4O3S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 3-[5-(3-nitrophenyl)-1,3,4-thiadiazol-2-yl]-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccccc2)N1c1nnc(-c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C17H12N4O3S2/c22-14-10-25-16(11-5-2-1-3-6-11)20(14)17-19-18-15(26-17)12-7-4-8-13(9-12)21(23)24/h1-9,16H,10H2 |
| InChIKey | BFOYOXWTIDMOAL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|