C16H27ClFN3 — CID 105240763
1-(2-chloro-6-fluorophenyl)-N,N-diethyl-2-hydrazinyl-3-methylpentan-3-amine (PubChem CID 105240763) has the molecular formula C16H27ClFN3 and a molecular weight of 315.86 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-N,N-diethyl-2-hydrazinyl-3-methylpentan-3-amine.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-N,N-diethyl-2-hydrazinyl-3-methylpentan-3-amine |
|---|---|
| PubChem CID | 105240763 |
| Molecular Formula | C16H27ClFN3 |
| Molecular Weight | 315.86 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-N,N-diethyl-2-hydrazinyl-3-methylpentan-3-amine |
| SMILES | CCN(CC)C(C)(CC)C(Cc1c(F)cccc1Cl)NN |
| InChI | InChI=1S/C16H27ClFN3/c1-5-16(4,21(6-2)7-3)15(20-19)11-12-13(17)9-8-10-14(12)18/h8-10,15,20H,5-7,11,19H2,1-4H3 |
| InChIKey | SRNRBPBHEXNURR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.86 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|