C14H26BrN5O — CID 105242499
1-[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-hydrazinylmethyl]-N,N-dimethylcyclopentan-1-amine (PubChem CID 105242499) has the molecular formula C14H26BrN5O and a molecular weight of 360.30 g/mol. Its IUPAC name is 1-[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-hydrazinylmethyl]-N,N-dimethylcyclopentan-1-amine.
| Compound Name | 1-[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-hydrazinylmethyl]-N,N-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 105242499 |
| Molecular Formula | C14H26BrN5O |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 1-[[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]-hydrazinylmethyl]-N,N-dimethylcyclopentan-1-amine |
| SMILES | COCCn1ncc(Br)c1C(NN)C1(N(C)C)CCCC1 |
| InChI | InChI=1S/C14H26BrN5O/c1-19(2)14(6-4-5-7-14)13(18-16)12-11(15)10-17-20(12)8-9-21-3/h10,13,18H,4-9,16H2,1-3H3 |
| InChIKey | AWPRNZCPOCALCW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|