C16H31N5 — CID 105243166
1-[1-hydrazinyl-2-(1-propan-2-ylpyrazol-3-yl)ethyl]-N,N-dimethylcyclohexan-1-amine (PubChem CID 105243166) has the molecular formula C16H31N5 and a molecular weight of 293.46 g/mol. Its IUPAC name is 1-[1-hydrazinyl-2-(1-propan-2-ylpyrazol-3-yl)ethyl]-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 1-[1-hydrazinyl-2-(1-propan-2-ylpyrazol-3-yl)ethyl]-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 105243166 |
| Molecular Formula | C16H31N5 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | 1-[1-hydrazinyl-2-(1-propan-2-ylpyrazol-3-yl)ethyl]-N,N-dimethylcyclohexan-1-amine |
| SMILES | CC(C)n1ccc(CC(NN)C2(N(C)C)CCCCC2)n1 |
| InChI | InChI=1S/C16H31N5/c1-13(2)21-11-8-14(19-21)12-15(18-17)16(20(3)4)9-6-5-7-10-16/h8,11,13,15,18H,5-7,9-10,12,17H2,1-4H3 |
| InChIKey | RXCAUKMRLLAQCV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|