C13H23N3 — CID 105244634
2-hydrazinyl-N,N-dimethyl-2-(4-propylphenyl)ethanamine (PubChem CID 105244634) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 2-hydrazinyl-N,N-dimethyl-2-(4-propylphenyl)ethanamine.
| Compound Name | 2-hydrazinyl-N,N-dimethyl-2-(4-propylphenyl)ethanamine |
|---|---|
| PubChem CID | 105244634 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 2-hydrazinyl-N,N-dimethyl-2-(4-propylphenyl)ethanamine |
| SMILES | CCCc1ccc(C(CN(C)C)NN)cc1 |
| InChI | InChI=1S/C13H23N3/c1-4-5-11-6-8-12(9-7-11)13(15-14)10-16(2)3/h6-9,13,15H,4-5,10,14H2,1-3H3 |
| InChIKey | WKCXNQRXJXBCMC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|