C16H28N2 — CID 116950082
N,3,3-trimethyl-1-(4-propylphenyl)butane-1,4-diamine (PubChem CID 116950082) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N,3,3-trimethyl-1-(4-propylphenyl)butane-1,4-diamine.
| Compound Name | N,3,3-trimethyl-1-(4-propylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116950082 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N,3,3-trimethyl-1-(4-propylphenyl)butane-1,4-diamine |
| SMILES | CCCc1ccc(C(CC(C)(C)CN)NC)cc1 |
| InChI | InChI=1S/C16H28N2/c1-5-6-13-7-9-14(10-8-13)15(18-4)11-16(2,3)12-17/h7-10,15,18H,5-6,11-12,17H2,1-4H3 |
| InChIKey | LLZBNFSBZDUXJU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |