C15H26N2S — CID 116950118
1-(4-ethylsulfanylphenyl)-N,3,3-trimethylbutane-1,4-diamine (PubChem CID 116950118) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is 1-(4-ethylsulfanylphenyl)-N,3,3-trimethylbutane-1,4-diamine.
| Compound Name | 1-(4-ethylsulfanylphenyl)-N,3,3-trimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116950118 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-(4-ethylsulfanylphenyl)-N,3,3-trimethylbutane-1,4-diamine |
| SMILES | CCSc1ccc(C(CC(C)(C)CN)NC)cc1 |
| InChI | InChI=1S/C15H26N2S/c1-5-18-13-8-6-12(7-9-13)14(17-4)10-15(2,3)11-16/h6-9,14,17H,5,10-11,16H2,1-4H3 |
| InChIKey | MGZJSXOBVXVGIZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |