C9H21N3 — CID 105244656
2-cyclopentyl-2-hydrazinyl-N,N-dimethylethanamine (PubChem CID 105244656) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is 2-cyclopentyl-2-hydrazinyl-N,N-dimethylethanamine.
| Compound Name | 2-cyclopentyl-2-hydrazinyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105244656 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 2-cyclopentyl-2-hydrazinyl-N,N-dimethylethanamine |
| SMILES | CN(C)CC(NN)C1CCCC1 |
| InChI | InChI=1S/C9H21N3/c1-12(2)7-9(11-10)8-5-3-4-6-8/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | BDFYXQKYRFLQLX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|