C22H22N2O5 — CID 10524659
2-[2-ethyl-1-oxamoyl-3-(2-phenylethyl)indolizin-8-yl]oxyacetic acid (PubChem CID 10524659) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-[2-ethyl-1-oxamoyl-3-(2-phenylethyl)indolizin-8-yl]oxyacetic acid.
| Compound Name | 2-[2-ethyl-1-oxamoyl-3-(2-phenylethyl)indolizin-8-yl]oxyacetic acid |
|---|---|
| PubChem CID | 10524659 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[2-ethyl-1-oxamoyl-3-(2-phenylethyl)indolizin-8-yl]oxyacetic acid |
| SMILES | CCc1c(C(=O)C(N)=O)c2c(OCC(=O)O)cccn2c1CCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O5/c1-2-15-16(11-10-14-7-4-3-5-8-14)24-12-6-9-17(29-13-18(25)26)20(24)19(15)21(27)22(23)28/h3-9,12H,2,10-11,13H2,1H3,(H2,23,28)(H,25,26) |
| InChIKey | GQHQYVUTXFSFSF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|