C14H30N4 — CID 105247326
[(1,4-dimethylpiperazin-2-yl)-(4-methylcyclohexyl)methyl]hydrazine (PubChem CID 105247326) has the molecular formula C14H30N4 and a molecular weight of 254.42 g/mol. Its IUPAC name is [(1,4-dimethylpiperazin-2-yl)-(4-methylcyclohexyl)methyl]hydrazine.
| Compound Name | [(1,4-dimethylpiperazin-2-yl)-(4-methylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105247326 |
| Molecular Formula | C14H30N4 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.25 |
| IUPAC Name | [(1,4-dimethylpiperazin-2-yl)-(4-methylcyclohexyl)methyl]hydrazine |
| SMILES | CC1CCC(C(NN)C2CN(C)CCN2C)CC1 |
| InChI | InChI=1S/C14H30N4/c1-11-4-6-12(7-5-11)14(16-15)13-10-17(2)8-9-18(13)3/h11-14,16H,4-10,15H2,1-3H3 |
| InChIKey | XIFJLBBPPDSYKQ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|