C13H25N5O — CID 105247836
[(1-ethylpyrazol-4-yl)-(4-propylmorpholin-2-yl)methyl]hydrazine (PubChem CID 105247836) has the molecular formula C13H25N5O and a molecular weight of 267.38 g/mol. Its IUPAC name is [(1-ethylpyrazol-4-yl)-(4-propylmorpholin-2-yl)methyl]hydrazine.
| Compound Name | [(1-ethylpyrazol-4-yl)-(4-propylmorpholin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105247836 |
| Molecular Formula | C13H25N5O |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | [(1-ethylpyrazol-4-yl)-(4-propylmorpholin-2-yl)methyl]hydrazine |
| SMILES | CCCN1CCOC(C(NN)c2cnn(CC)c2)C1 |
| InChI | InChI=1S/C13H25N5O/c1-3-5-17-6-7-19-12(10-17)13(16-14)11-8-15-18(4-2)9-11/h8-9,12-13,16H,3-7,10,14H2,1-2H3 |
| InChIKey | KOWRHDYNNYIEBT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|