C12H20BrN3OS — CID 105247967
[(3-bromothiophen-2-yl)-(4-propylmorpholin-2-yl)methyl]hydrazine (PubChem CID 105247967) has the molecular formula C12H20BrN3OS and a molecular weight of 334.28 g/mol. Its IUPAC name is [(3-bromothiophen-2-yl)-(4-propylmorpholin-2-yl)methyl]hydrazine.
| Compound Name | [(3-bromothiophen-2-yl)-(4-propylmorpholin-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105247967 |
| Molecular Formula | C12H20BrN3OS |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | [(3-bromothiophen-2-yl)-(4-propylmorpholin-2-yl)methyl]hydrazine |
| SMILES | CCCN1CCOC(C(NN)c2sccc2Br)C1 |
| InChI | InChI=1S/C12H20BrN3OS/c1-2-4-16-5-6-17-10(8-16)11(15-14)12-9(13)3-7-18-12/h3,7,10-11,15H,2,4-6,8,14H2,1H3 |
| InChIKey | FFLGZURLRJPCNU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|