C13H21BrN2OS — CID 79675911
1-(4-bromothiophen-3-yl)-N-methyl-1-(4-propylmorpholin-2-yl)methanamine (PubChem CID 79675911) has the molecular formula C13H21BrN2OS and a molecular weight of 333.30 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-N-methyl-1-(4-propylmorpholin-2-yl)methanamine.
| Compound Name | 1-(4-bromothiophen-3-yl)-N-methyl-1-(4-propylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 79675911 |
| Molecular Formula | C13H21BrN2OS |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-N-methyl-1-(4-propylmorpholin-2-yl)methanamine |
| SMILES | CCCN1CCOC(C(NC)c2cscc2Br)C1 |
| InChI | InChI=1S/C13H21BrN2OS/c1-3-4-16-5-6-17-12(7-16)13(15-2)10-8-18-9-11(10)14/h8-9,12-13,15H,3-7H2,1-2H3 |
| InChIKey | CGGSQJBNGXBWBI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |