C13H18ClFN6 — CID 105248398
2-[4-chloro-5-[(5-fluoro-2-pyridinyl)-hydrazinylmethyl]pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 105248398) has the molecular formula C13H18ClFN6 and a molecular weight of 312.78 g/mol. Its IUPAC name is 2-[4-chloro-5-[(5-fluoro-2-pyridinyl)-hydrazinylmethyl]pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-chloro-5-[(5-fluoro-2-pyridinyl)-hydrazinylmethyl]pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105248398 |
| Molecular Formula | C13H18ClFN6 |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-[4-chloro-5-[(5-fluoro-2-pyridinyl)-hydrazinylmethyl]pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ncc(Cl)c1C(NN)c1ccc(F)cn1 |
| InChI | InChI=1S/C13H18ClFN6/c1-20(2)5-6-21-13(10(14)8-18-21)12(19-16)11-4-3-9(15)7-17-11/h3-4,7-8,12,19H,5-6,16H2,1-2H3 |
| InChIKey | IYRMWQQNNAVPRG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|